C22H29NO7S — CID 13178889
1-(4-methoxy-3-methylsulfanylphenyl)-N-[2-(2-methoxyphenoxy)ethyl]propan-2-amine;oxalic acid (PubChem CID 13178889) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is 1-(4-methoxy-3-methylsulfanylphenyl)-N-[2-(2-methoxyphenoxy)ethyl]propan-2-amine;oxalic acid.
| Compound Name | 1-(4-methoxy-3-methylsulfanylphenyl)-N-[2-(2-methoxyphenoxy)ethyl]propan-2-amine;oxalic acid |
|---|---|
| PubChem CID | 13178889 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-(4-methoxy-3-methylsulfanylphenyl)-N-[2-(2-methoxyphenoxy)ethyl]propan-2-amine;oxalic acid |
| SMILES | COc1ccccc1OCCNC(C)Cc1ccc(OC)c(SC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H27NO3S.C2H2O4/c1-15(13-16-9-10-19(23-3)20(14-16)25-4)21-11-12-24-18-8-6-5-7-17(18)22-2;3-1(4)2(5)6/h5-10,14-15,21H,11-13H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | OJBCJJQIQQDHLN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|