C21H27FN2O9S — CID 22157052
3-[2-[2-(5-fluoro-2-methoxyphenoxy)ethylamino]propyl]-4-methoxybenzenesulfonamide;oxalic acid (PubChem CID 22157052) has the molecular formula C21H27FN2O9S and a molecular weight of 502.52 g/mol. Its IUPAC name is 3-[2-[2-(5-fluoro-2-methoxyphenoxy)ethylamino]propyl]-4-methoxybenzenesulfonamide;oxalic acid.
| Compound Name | 3-[2-[2-(5-fluoro-2-methoxyphenoxy)ethylamino]propyl]-4-methoxybenzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 22157052 |
| Molecular Formula | C21H27FN2O9S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 3-[2-[2-(5-fluoro-2-methoxyphenoxy)ethylamino]propyl]-4-methoxybenzenesulfonamide;oxalic acid |
| SMILES | COc1ccc(S(N)(=O)=O)cc1CC(C)NCCOc1cc(F)ccc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25FN2O5S.C2H2O4/c1-13(10-14-11-16(28(21,23)24)5-7-17(14)25-2)22-8-9-27-19-12-15(20)4-6-18(19)26-3;3-1(4)2(5)6/h4-7,11-13,22H,8-10H2,1-3H3,(H2,21,23,24);(H,3,4)(H,5,6) |
| InChIKey | NAKKYTWTQDDDIK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 174.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|