C13H19NO5S — CID 65381863
2-methylpropyl 2-(2-methoxy-5-sulfamoylphenyl)acetate (PubChem CID 65381863) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-methylpropyl 2-(2-methoxy-5-sulfamoylphenyl)acetate.
| Compound Name | 2-methylpropyl 2-(2-methoxy-5-sulfamoylphenyl)acetate |
|---|---|
| PubChem CID | 65381863 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-methylpropyl 2-(2-methoxy-5-sulfamoylphenyl)acetate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1CC(=O)OCC(C)C |
| InChI | InChI=1S/C13H19NO5S/c1-9(2)8-19-13(15)7-10-6-11(20(14,16)17)4-5-12(10)18-3/h4-6,9H,7-8H2,1-3H3,(H2,14,16,17) |
| InChIKey | YNMCETOHUMORLK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |