C14H21NO5S — CID 103286167
2-methylpentyl 2-methoxy-5-sulfamoylbenzoate (PubChem CID 103286167) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-methylpentyl 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | 2-methylpentyl 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 103286167 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-methylpentyl 2-methoxy-5-sulfamoylbenzoate |
| SMILES | CCCC(C)COC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C14H21NO5S/c1-4-5-10(2)9-20-14(16)12-8-11(21(15,17)18)6-7-13(12)19-3/h6-8,10H,4-5,9H2,1-3H3,(H2,15,17,18) |
| InChIKey | BWIWGSYTCHFQJD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |