C13H18N2O6S — CID 7467931
[2-oxo-2-(propan-2-ylamino)ethyl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 7467931) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7467931 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)NC(C)C |
| InChI | InChI=1S/C13H18N2O6S/c1-8(2)15-12(16)7-21-13(17)10-6-9(22(14,18)19)4-5-11(10)20-3/h4-6,8H,7H2,1-3H3,(H,15,16)(H2,14,18,19) |
| InChIKey | ZERWUKOULMNIMU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |