C18H20N2O8S — CID 16518490
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16518490) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16518490 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(S(N)(=O)=O)ccc2OC)cc(OC)c1 |
| InChI | InChI=1S/C18H20N2O8S/c1-25-12-6-11(7-13(8-12)26-2)20-17(21)10-28-18(22)15-9-14(29(19,23)24)4-5-16(15)27-3/h4-9H,10H2,1-3H3,(H,20,21)(H2,19,23,24) |
| InChIKey | IKUZUXDRNZCRCQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |