C19H22N2O7S — CID 16556676
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2,5-dimethoxybenzoate (PubChem CID 16556676) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2,5-dimethoxybenzoate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 16556676 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2,5-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)OCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H22N2O7S/c1-26-14-5-8-17(27-2)16(11-14)19(23)28-12-18(22)21-10-9-13-3-6-15(7-4-13)29(20,24)25/h3-8,11H,9-10,12H2,1-2H3,(H,21,22)(H2,20,24,25) |
| InChIKey | YWOSMUBVRABQTB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |