C17H20N2O4S2 — CID 35040882
2-(3-methoxyphenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 35040882) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(3-methoxyphenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 35040882 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-(3-methoxyphenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | COc1cccc(SCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-23-14-3-2-4-15(11-14)24-12-17(20)19-10-9-13-5-7-16(8-6-13)25(18,21)22/h2-8,11H,9-10,12H2,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | HWWBNGTUXWBWHI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |