C12H18N2O2S — CID 119503641
2-(3-methoxyphenyl)sulfanyl-N-[2-(methylamino)ethyl]acetamide (PubChem CID 119503641) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)sulfanyl-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | 2-(3-methoxyphenyl)sulfanyl-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 119503641 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3-methoxyphenyl)sulfanyl-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCNC(=O)CSc1cccc(OC)c1 |
| InChI | InChI=1S/C12H18N2O2S/c1-13-6-7-14-12(15)9-17-11-5-3-4-10(8-11)16-2/h3-5,8,13H,6-7,9H2,1-2H3,(H,14,15) |
| InChIKey | PYAAQNPRERCJMJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|