C20H25NO4S — CID 46769228
2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-(3-methoxyphenyl)propyl]acetamide (PubChem CID 46769228) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-(3-methoxyphenyl)propyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-(3-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 46769228 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-(3-methoxyphenyl)propyl]acetamide |
| SMILES | COc1cccc(CCCNC(=O)CSc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H25NO4S/c1-23-16-8-4-6-15(12-16)7-5-11-21-20(22)14-26-17-9-10-18(24-2)19(13-17)25-3/h4,6,8-10,12-13H,5,7,11,14H2,1-3H3,(H,21,22) |
| InChIKey | FGBPFNOZEHDLEA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|