C15H12Cl3NO2S — CID 35040704
2-(3-methoxyphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 35040704) has the molecular formula C15H12Cl3NO2S and a molecular weight of 376.69 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(3-methoxyphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 35040704 |
| Molecular Formula | C15H12Cl3NO2S |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2-(3-methoxyphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | COc1cccc(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl3NO2S/c1-21-9-3-2-4-10(5-9)22-8-15(20)19-14-7-12(17)11(16)6-13(14)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | IAKUZOCLZMGLMK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|