C12H20ClN3O4S — CID 119697481
N-(2-methoxy-5-sulfamoylphenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119697481) has the molecular formula C12H20ClN3O4S and a molecular weight of 337.83 g/mol. Its IUPAC name is N-(2-methoxy-5-sulfamoylphenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-(2-methoxy-5-sulfamoylphenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119697481 |
| Molecular Formula | C12H20ClN3O4S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(2-methoxy-5-sulfamoylphenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cc(S(N)(=O)=O)ccc1OC.Cl |
| InChI | InChI=1S/C12H19N3O4S.ClH/c1-8(7-14-2)12(16)15-10-6-9(20(13,17)18)4-5-11(10)19-3;/h4-6,8,14H,7H2,1-3H3,(H,15,16)(H2,13,17,18);1H |
| InChIKey | WWQZGNANJUBRIV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |