C21H29FN2O5S — CID 15034474
5-[2-[4-(5-fluoro-2-methoxyphenoxy)butylamino]propyl]-2-methoxybenzenesulfonamide (PubChem CID 15034474) has the molecular formula C21H29FN2O5S and a molecular weight of 440.54 g/mol. Its IUPAC name is 5-[2-[4-(5-fluoro-2-methoxyphenoxy)butylamino]propyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[2-[4-(5-fluoro-2-methoxyphenoxy)butylamino]propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 15034474 |
| Molecular Formula | C21H29FN2O5S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 5-[2-[4-(5-fluoro-2-methoxyphenoxy)butylamino]propyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(F)cc1OCCCCNC(C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C21H29FN2O5S/c1-15(12-16-6-8-19(28-3)21(13-16)30(23,25)26)24-10-4-5-11-29-20-14-17(22)7-9-18(20)27-2/h6-9,13-15,24H,4-5,10-12H2,1-3H3,(H2,23,25,26) |
| InChIKey | VPDHKEJVWJGIIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|