C18H23FN2O4S — CID 70876190
5-[(2R)-2-[2-(2-fluorophenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide (PubChem CID 70876190) has the molecular formula C18H23FN2O4S and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[(2R)-2-[2-(2-fluorophenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[(2R)-2-[2-(2-fluorophenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 70876190 |
| Molecular Formula | C18H23FN2O4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-[(2R)-2-[2-(2-fluorophenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(C[C@@H](C)NCCOc2ccccc2F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H23FN2O4S/c1-13(21-9-10-25-16-6-4-3-5-15(16)19)11-14-7-8-17(24-2)18(12-14)26(20,22)23/h3-8,12-13,21H,9-11H2,1-2H3,(H2,20,22,23)/t13-/m1/s1 |
| InChIKey | RBSHLKVGMFZPTH-CYBMUJFWSA-N |
| XLogP | 2.08 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|