C20H27FN2O5S — CID 67896034
5-[2-[2-(3-fluoro-2-methoxyphenoxy)ethylamino]propyl]-2-methoxy-N-methylbenzenesulfonamide (PubChem CID 67896034) has the molecular formula C20H27FN2O5S and a molecular weight of 426.51 g/mol. Its IUPAC name is 5-[2-[2-(3-fluoro-2-methoxyphenoxy)ethylamino]propyl]-2-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 5-[2-[2-(3-fluoro-2-methoxyphenoxy)ethylamino]propyl]-2-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67896034 |
| Molecular Formula | C20H27FN2O5S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-[2-[2-(3-fluoro-2-methoxyphenoxy)ethylamino]propyl]-2-methoxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(CC(C)NCCOc2cccc(F)c2OC)ccc1OC |
| InChI | InChI=1S/C20H27FN2O5S/c1-14(23-10-11-28-18-7-5-6-16(21)20(18)27-4)12-15-8-9-17(26-3)19(13-15)29(24,25)22-2/h5-9,13-14,22-23H,10-12H2,1-4H3 |
| InChIKey | DFFKAQFPEBXQTA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|