C18H24N2O3S — CID 14179760
2-methoxy-5-[2-(1-phenylethylamino)propyl]benzenesulfonamide (PubChem CID 14179760) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-methoxy-5-[2-(1-phenylethylamino)propyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-[2-(1-phenylethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 14179760 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-methoxy-5-[2-(1-phenylethylamino)propyl]benzenesulfonamide |
| SMILES | COc1ccc(CC(C)NC(C)c2ccccc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H24N2O3S/c1-13(20-14(2)16-7-5-4-6-8-16)11-15-9-10-17(23-3)18(12-15)24(19,21)22/h4-10,12-14,20H,11H2,1-3H3,(H2,19,21,22) |
| InChIKey | XRWQXURPDHPHTH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |