C14H24N2O4S2 — CID 25268876
5-[(2R)-2-[[(R)-tert-butylsulfinyl]amino]propyl]-2-methoxybenzenesulfonamide (PubChem CID 25268876) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 5-[(2R)-2-[[(R)-tert-butylsulfinyl]amino]propyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[(2R)-2-[[(R)-tert-butylsulfinyl]amino]propyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 25268876 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-[(2R)-2-[[(R)-tert-butylsulfinyl]amino]propyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(C[C@@H](C)N[S@](=O)C(C)(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H24N2O4S2/c1-10(16-21(17)14(2,3)4)8-11-6-7-12(20-5)13(9-11)22(15,18)19/h6-7,9-10,16H,8H2,1-5H3,(H2,15,18,19)/t10-,21-/m1/s1 |
| InChIKey | CVYXCIDOADZLGO-LADRHHBVSA-N |
| XLogP | 1.33 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |