C19H26ClN2O4S- — CID 162016483
1-(hydroxymethyl)-4-[(2R)-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-(sulfinatoamino)benzene;hydrochloride (PubChem CID 162016483) has the molecular formula C19H26ClN2O4S- and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-(hydroxymethyl)-4-[(2R)-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-(sulfinatoamino)benzene;hydrochloride.
| Compound Name | 1-(hydroxymethyl)-4-[(2R)-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-(sulfinatoamino)benzene;hydrochloride |
|---|---|
| PubChem CID | 162016483 |
| Molecular Formula | C19H26ClN2O4S- |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-(hydroxymethyl)-4-[(2R)-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-(sulfinatoamino)benzene;hydrochloride |
| SMILES | Cc1ccccc1OCCN[C@H](C)Cc1ccc(CO)c(NS(=O)[O-])c1.Cl |
| InChI | InChI=1S/C19H26N2O4S.ClH/c1-14-5-3-4-6-19(14)25-10-9-20-15(2)11-16-7-8-17(13-22)18(12-16)21-26(23)24;/h3-8,12,15,20-22H,9-11,13H2,1-2H3,(H,23,24);1H/p-1/t15-;/m1./s1 |
| InChIKey | YJHBKTZUSUKZII-XFULWGLBSA-M |
| XLogP | 2.71 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|