C20H24FN3O3 — CID 72873722
N-[2-fluoro-5-[2-(2-methylphenoxy)ethylcarbamoylamino]phenyl]-2-methylpropanamide (PubChem CID 72873722) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[2-fluoro-5-[2-(2-methylphenoxy)ethylcarbamoylamino]phenyl]-2-methylpropanamide.
| Compound Name | N-[2-fluoro-5-[2-(2-methylphenoxy)ethylcarbamoylamino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 72873722 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[2-fluoro-5-[2-(2-methylphenoxy)ethylcarbamoylamino]phenyl]-2-methylpropanamide |
| SMILES | Cc1ccccc1OCCNC(=O)Nc1ccc(F)c(NC(=O)C(C)C)c1 |
| InChI | InChI=1S/C20H24FN3O3/c1-13(2)19(25)24-17-12-15(8-9-16(17)21)23-20(26)22-10-11-27-18-7-5-4-6-14(18)3/h4-9,12-13H,10-11H2,1-3H3,(H,24,25)(H2,22,23,26) |
| InChIKey | NRKHSXWMIHBCPX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|