C18H22FN3O3 — CID 118785479
N-[2-fluoro-5-[2-(5-methylfuran-2-yl)ethylcarbamoylamino]phenyl]-2-methylpropanamide (PubChem CID 118785479) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[2-fluoro-5-[2-(5-methylfuran-2-yl)ethylcarbamoylamino]phenyl]-2-methylpropanamide.
| Compound Name | N-[2-fluoro-5-[2-(5-methylfuran-2-yl)ethylcarbamoylamino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 118785479 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-fluoro-5-[2-(5-methylfuran-2-yl)ethylcarbamoylamino]phenyl]-2-methylpropanamide |
| SMILES | Cc1ccc(CCNC(=O)Nc2ccc(F)c(NC(=O)C(C)C)c2)o1 |
| InChI | InChI=1S/C18H22FN3O3/c1-11(2)17(23)22-16-10-13(5-7-15(16)19)21-18(24)20-9-8-14-6-4-12(3)25-14/h4-7,10-11H,8-9H2,1-3H3,(H,22,23)(H2,20,21,24) |
| InChIKey | MCDHIHODVCWSCB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |