C27H36FN3O4 — CID 86343240
5-[(2R)-2-[2-[4-fluoro-2-[(2-methylpropan-2-yl)oxy]phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide (PubChem CID 86343240) has the molecular formula C27H36FN3O4 and a molecular weight of 485.60 g/mol. Its IUPAC name is 5-[(2R)-2-[2-[4-fluoro-2-[(2-methylpropan-2-yl)oxy]phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide.
| Compound Name | 5-[(2R)-2-[2-[4-fluoro-2-[(2-methylpropan-2-yl)oxy]phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 86343240 |
| Molecular Formula | C27H36FN3O4 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 5-[(2R)-2-[2-[4-fluoro-2-[(2-methylpropan-2-yl)oxy]phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
| SMILES | C[C@H](Cc1cc(C(N)=O)c2c(ccn2CCCO)c1)NCCOc1ccc(F)cc1OC(C)(C)C |
| InChI | InChI=1S/C27H36FN3O4/c1-18(30-9-13-34-23-7-6-21(28)17-24(23)35-27(2,3)4)14-19-15-20-8-11-31(10-5-12-32)25(20)22(16-19)26(29)33/h6-8,11,15-18,30,32H,5,9-10,12-14H2,1-4H3,(H2,29,33)/t18-/m1/s1 |
| InChIKey | AWAILTQVHUDAKC-GOSISDBHSA-N |
| XLogP | 4.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|