C29H41N3O4 — CID 123963407
5-[2-[2-[2-(cyclopropylmethoxy)-4-ethylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide (PubChem CID 123963407) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is 5-[2-[2-[2-(cyclopropylmethoxy)-4-ethylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide.
| Compound Name | 5-[2-[2-[2-(cyclopropylmethoxy)-4-ethylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide |
|---|---|
| PubChem CID | 123963407 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 5-[2-[2-[2-(cyclopropylmethoxy)-4-ethylphenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)-2,3-dihydroindole-7-carboxamide |
| SMILES | CCc1ccc(OCCNC(C)Cc2cc3c(c(C(N)=O)c2)N(CCCO)CC3)c(OCC2CC2)c1 |
| InChI | InChI=1S/C29H41N3O4/c1-3-21-7-8-26(27(18-21)36-19-22-5-6-22)35-14-10-31-20(2)15-23-16-24-9-12-32(11-4-13-33)28(24)25(17-23)29(30)34/h7-8,16-18,20,22,31,33H,3-6,9-15,19H2,1-2H3,(H2,30,34) |
| InChIKey | MPBUJYKMPLSCGI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|