C32H37N3O4 — CID 18360864
3-[7-cyano-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2,3-dihydroindol-1-yl]propyl benzoate (PubChem CID 18360864) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-[7-cyano-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2,3-dihydroindol-1-yl]propyl benzoate.
| Compound Name | 3-[7-cyano-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2,3-dihydroindol-1-yl]propyl benzoate |
|---|---|
| PubChem CID | 18360864 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 3-[7-cyano-5-[2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2,3-dihydroindol-1-yl]propyl benzoate |
| SMILES | CCOc1ccccc1OCCNC(C)Cc1cc(C#N)c2c(c1)CCN2CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H37N3O4/c1-3-37-29-12-7-8-13-30(29)38-19-15-34-24(2)20-25-21-27-14-17-35(31(27)28(22-25)23-33)16-9-18-39-32(36)26-10-5-4-6-11-26/h4-8,10-13,21-22,24,34H,3,9,14-20H2,1-2H3 |
| InChIKey | IENUJLYMYCPJBQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|