C29H29N3O3 — CID 146157402
3-[5-[2-(benzylamino)propanoyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate (PubChem CID 146157402) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[5-[2-(benzylamino)propanoyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate.
| Compound Name | 3-[5-[2-(benzylamino)propanoyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate |
|---|---|
| PubChem CID | 146157402 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-[5-[2-(benzylamino)propanoyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate |
| SMILES | CC(NCc1ccccc1)C(=O)c1cc(C#N)c2c(c1)CCN2CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O3/c1-21(31-20-22-9-4-2-5-10-22)28(33)25-17-24-13-15-32(27(24)26(18-25)19-30)14-8-16-35-29(34)23-11-6-3-7-12-23/h2-7,9-12,17-18,21,31H,8,13-16,20H2,1H3 |
| InChIKey | OGTVXJHAGHXOTF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|