C29H31N3O2 — CID 71609511
3-[5-[(2S)-2-(benzylamino)propyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate (PubChem CID 71609511) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-[5-[(2S)-2-(benzylamino)propyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate.
| Compound Name | 3-[5-[(2S)-2-(benzylamino)propyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate |
|---|---|
| PubChem CID | 71609511 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-[5-[(2S)-2-(benzylamino)propyl]-7-cyano-2,3-dihydroindol-1-yl]propyl benzoate |
| SMILES | C[C@@H](Cc1cc(C#N)c2c(c1)CCN2CCCOC(=O)c1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C29H31N3O2/c1-22(31-21-23-9-4-2-5-10-23)17-24-18-26-13-15-32(28(26)27(19-24)20-30)14-8-16-34-29(33)25-11-6-3-7-12-25/h2-7,9-12,18-19,22,31H,8,13-17,21H2,1H3/t22-/m0/s1 |
| InChIKey | BMSBBIRIWBUFLD-QFIPXVFZSA-N |
| XLogP | 4.89 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|