C29H33BrN2O3 — CID 16744314
benzyl N-[(2R)-1-[7-bromo-1-(3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate (PubChem CID 16744314) has the molecular formula C29H33BrN2O3 and a molecular weight of 537.50 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[7-bromo-1-(3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[7-bromo-1-(3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 16744314 |
| Molecular Formula | C29H33BrN2O3 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | benzyl N-[(2R)-1-[7-bromo-1-(3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate |
| SMILES | C[C@H](Cc1cc(Br)c2c(c1)CCN2CCCOCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H33BrN2O3/c1-22(31-29(33)35-21-24-11-6-3-7-12-24)17-25-18-26-13-15-32(28(26)27(30)19-25)14-8-16-34-20-23-9-4-2-5-10-23/h2-7,9-12,18-19,22H,8,13-17,20-21H2,1H3,(H,31,33)/t22-/m1/s1 |
| InChIKey | NSISOBSILSHQEI-JOCHJYFZSA-N |
| XLogP | 6.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|