C31H37BrCl2N2O3 — CID 90687534
benzyl N-[(2S)-1-[7-bromo-1-(1,1,2,2,3,3-hexadeuterio-3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate;1,1-dichloroethane (PubChem CID 90687534) has the molecular formula C31H37BrCl2N2O3 and a molecular weight of 642.49 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[7-bromo-1-(1,1,2,2,3,3-hexadeuterio-3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate;1,1-dichloroethane.
| Compound Name | benzyl N-[(2S)-1-[7-bromo-1-(1,1,2,2,3,3-hexadeuterio-3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate;1,1-dichloroethane |
|---|---|
| PubChem CID | 90687534 |
| Molecular Formula | C31H37BrCl2N2O3 |
| Molecular Weight | 642.49 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | benzyl N-[(2S)-1-[7-bromo-1-(1,1,2,2,3,3-hexadeuterio-3-phenylmethoxypropyl)-2,3-dihydroindol-5-yl]propan-2-yl]carbamate;1,1-dichloroethane |
| SMILES | CC(Cl)Cl.[2H]C([2H])(OCc1ccccc1)C([2H])([2H])C([2H])([2H])N1CCc2cc(C[C@H](C)NC(=O)OCc3ccccc3)cc(Br)c21 |
| InChI | InChI=1S/C29H33BrN2O3.C2H4Cl2/c1-22(31-29(33)35-21-24-11-6-3-7-12-24)17-25-18-26-13-15-32(28(26)27(30)19-25)14-8-16-34-20-23-9-4-2-5-10-23;1-2(3)4/h2-7,9-12,18-19,22H,8,13-17,20-21H2,1H3,(H,31,33);2H,1H3/t22-;/m0./s1/i8D2,14D2,16D2; |
| InChIKey | LUNCDPBMOFKPBE-DKDOOJOASA-N |
| XLogP | 8.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.49 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|