C18H20NO5P — CID 121288754
CID 121288754 (PubChem CID 121288754) has the molecular formula C18H20NO5P and a molecular weight of 361.33 g/mol.
| Compound Name | CID 121288754 |
|---|---|
| PubChem CID | 121288754 |
| Molecular Formula | C18H20NO5P |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C[C@@H](C)NC(=O)OCc2ccccc2)cc1OP(=O)=O |
| InChI | InChI=1S/C18H20NO5P/c1-13-8-9-16(11-17(13)24-25(21)22)10-14(2)19-18(20)23-12-15-6-4-3-5-7-15/h3-9,11,14H,10,12H2,1-2H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | ITLVQSWQNDINPP-CQSZACIVSA-N |
| XLogP | 4.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|