C20H30N2O2 — CID 144676201
ethane;5-(2-oxopropyl)-1-(3-propoxypropyl)-2,3-dihydroindole-7-carbonitrile (PubChem CID 144676201) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is ethane;5-(2-oxopropyl)-1-(3-propoxypropyl)-2,3-dihydroindole-7-carbonitrile.
| Compound Name | ethane;5-(2-oxopropyl)-1-(3-propoxypropyl)-2,3-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 144676201 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | ethane;5-(2-oxopropyl)-1-(3-propoxypropyl)-2,3-dihydroindole-7-carbonitrile |
| SMILES | CC.CCCOCCCN1CCc2cc(CC(C)=O)cc(C#N)c21 |
| InChI | InChI=1S/C18H24N2O2.C2H6/c1-3-8-22-9-4-6-20-7-5-16-11-15(10-14(2)21)12-17(13-19)18(16)20;1-2/h11-12H,3-10H2,1-2H3;1-2H3 |
| InChIKey | CMVOJZAGQSIUSV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|