C19H21BrN2O — CID 144941433
5-bromo-1-[3-[(2E)-2-ethenylpenta-2,4-dienoxy]propyl]-2,3-dihydroindole-7-carbonitrile (PubChem CID 144941433) has the molecular formula C19H21BrN2O and a molecular weight of 373.29 g/mol. Its IUPAC name is 5-bromo-1-[3-[(2E)-2-ethenylpenta-2,4-dienoxy]propyl]-2,3-dihydroindole-7-carbonitrile.
| Compound Name | 5-bromo-1-[3-[(2E)-2-ethenylpenta-2,4-dienoxy]propyl]-2,3-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 144941433 |
| Molecular Formula | C19H21BrN2O |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 5-bromo-1-[3-[(2E)-2-ethenylpenta-2,4-dienoxy]propyl]-2,3-dihydroindole-7-carbonitrile |
| SMILES | C=C/C=C(\C=C)COCCCN1CCc2cc(Br)cc(C#N)c21 |
| InChI | InChI=1S/C19H21BrN2O/c1-3-6-15(4-2)14-23-10-5-8-22-9-7-16-11-18(20)12-17(13-21)19(16)22/h3-4,6,11-12H,1-2,5,7-10,14H2/b15-6+ |
| InChIKey | KIYPUMIEXAXEDT-GIDUJCDVSA-N |
| XLogP | 4.39 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|