C36H33N3O4 — CID 145309157
3-[7-cyano-5-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2,3-dihydroindol-1-yl]propyl benzoate (PubChem CID 145309157) has the molecular formula C36H33N3O4 and a molecular weight of 571.68 g/mol. Its IUPAC name is 3-[7-cyano-5-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2,3-dihydroindol-1-yl]propyl benzoate.
| Compound Name | 3-[7-cyano-5-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2,3-dihydroindol-1-yl]propyl benzoate |
|---|---|
| PubChem CID | 145309157 |
| Molecular Formula | C36H33N3O4 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 3-[7-cyano-5-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2,3-dihydroindol-1-yl]propyl benzoate |
| SMILES | N#Cc1cc(CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc2c1N(CCCOC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C36H33N3O4/c37-23-28-22-25(21-27-16-19-39(34(27)28)18-8-20-42-35(40)26-9-2-1-3-10-26)15-17-38-36(41)43-24-33-31-13-6-4-11-29(31)30-12-5-7-14-32(30)33/h1-7,9-14,21-22,33H,8,15-20,24H2,(H,38,41) |
| InChIKey | BFPMJBVAYOGYSP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|