C23H26N2O4 — CID 145309128
3-[5-(2-acetamidoethyl)-7-formyl-2,3-dihydroindol-1-yl]propyl benzoate (PubChem CID 145309128) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-[5-(2-acetamidoethyl)-7-formyl-2,3-dihydroindol-1-yl]propyl benzoate.
| Compound Name | 3-[5-(2-acetamidoethyl)-7-formyl-2,3-dihydroindol-1-yl]propyl benzoate |
|---|---|
| PubChem CID | 145309128 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-[5-(2-acetamidoethyl)-7-formyl-2,3-dihydroindol-1-yl]propyl benzoate |
| SMILES | CC(=O)NCCc1cc(C=O)c2c(c1)CCN2CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c1-17(27)24-10-8-18-14-20-9-12-25(22(20)21(15-18)16-26)11-5-13-29-23(28)19-6-3-2-4-7-19/h2-4,6-7,14-16H,5,8-13H2,1H3,(H,24,27) |
| InChIKey | ABICXGIYLHPWMU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|