C27H23FN2O2 — CID 170492640
9H-fluoren-9-ylmethyl N-[4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enyl]carbamate (PubChem CID 170492640) has the molecular formula C27H23FN2O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492640 |
| Molecular Formula | C27H23FN2O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[2-(cyanomethyl)-5-fluorophenyl]but-3-enyl]carbamate |
| SMILES | N#CCc1ccc(F)cc1C=CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H23FN2O2/c28-21-13-12-19(14-15-29)20(17-21)7-5-6-16-30-27(31)32-18-26-24-10-3-1-8-22(24)23-9-2-4-11-25(23)26/h1-5,7-13,17,26H,6,14,16,18H2,(H,30,31) |
| InChIKey | VLKGGXKYSIHWIN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|