C26H23FN2O4 — CID 170492890
2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-fluorobenzoic acid (PubChem CID 170492890) has the molecular formula C26H23FN2O4 and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-fluorobenzoic acid.
| Compound Name | 2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 170492890 |
| Molecular Formula | C26H23FN2O4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-amino-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-fluorobenzoic acid |
| SMILES | Nc1cc(F)c(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C26H23FN2O4/c27-23-14-24(28)21(25(30)31)13-16(23)7-5-6-12-29-26(32)33-15-22-19-10-3-1-8-17(19)18-9-2-4-11-20(18)22/h1-5,7-11,13-14,22H,6,12,15,28H2,(H,29,32)(H,30,31) |
| InChIKey | DDIHRYFBGMTSLB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|