C26H23FN2O3 — CID 170492707
9H-fluoren-9-ylmethyl N-[4-(2-carbamoyl-5-fluorophenyl)but-3-enyl]carbamate (PubChem CID 170492707) has the molecular formula C26H23FN2O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-carbamoyl-5-fluorophenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-carbamoyl-5-fluorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492707 |
| Molecular Formula | C26H23FN2O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-carbamoyl-5-fluorophenyl)but-3-enyl]carbamate |
| SMILES | NC(=O)c1ccc(F)cc1C=CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H23FN2O3/c27-18-12-13-19(25(28)30)17(15-18)7-5-6-14-29-26(31)32-16-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-5,7-13,15,24H,6,14,16H2,(H2,28,30)(H,29,31) |
| InChIKey | MGPWUPDMUGQOHW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|