C26H22FNO4 — CID 170492507
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-5-fluorobenzoic acid (PubChem CID 170492507) has the molecular formula C26H22FNO4 and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-5-fluorobenzoic acid.
| Compound Name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 170492507 |
| Molecular Formula | C26H22FNO4 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-5-fluorobenzoic acid |
| SMILES | O=C(NCCC=Cc1ccc(F)cc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H22FNO4/c27-18-13-12-17(23(15-18)25(29)30)7-5-6-14-28-26(31)32-16-24-21-10-3-1-8-19(21)20-9-2-4-11-22(20)24/h1-5,7-13,15,24H,6,14,16H2,(H,28,31)(H,29,30) |
| InChIKey | VIRFZLNZYVVPJM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|