C24H20F2N2O2 — CID 169469609
9H-fluoren-9-ylmethyl N-[3-(4-amino-2,5-difluorophenyl)prop-2-enyl]carbamate (PubChem CID 169469609) has the molecular formula C24H20F2N2O2 and a molecular weight of 406.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-amino-2,5-difluorophenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-amino-2,5-difluorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469609 |
| Molecular Formula | C24H20F2N2O2 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-amino-2,5-difluorophenyl)prop-2-enyl]carbamate |
| SMILES | Nc1cc(F)c(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1F |
| InChI | InChI=1S/C24H20F2N2O2/c25-21-13-23(27)22(26)12-15(21)6-5-11-28-24(29)30-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-10,12-13,20H,11,14,27H2,(H,28,29) |
| InChIKey | RRJLSMDNOGLYKP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|