C25H21FN2O4 — CID 169470197
9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-methyl-5-nitrophenyl)prop-2-enyl]carbamate (PubChem CID 169470197) has the molecular formula C25H21FN2O4 and a molecular weight of 432.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-methyl-5-nitrophenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-methyl-5-nitrophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470197 |
| Molecular Formula | C25H21FN2O4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-methyl-5-nitrophenyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(F)c(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21FN2O4/c1-16-13-23(26)17(14-24(16)28(30)31)7-6-12-27-25(29)32-15-22-20-10-4-2-8-18(20)19-9-3-5-11-21(19)22/h2-11,13-14,22H,12,15H2,1H3,(H,27,29) |
| InChIKey | OBOHWHABUUVYEY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|