C26H25NO2 — CID 169469085
9H-fluoren-9-ylmethyl N-[3-(2,5-dimethylphenyl)prop-2-enyl]carbamate (PubChem CID 169469085) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,5-dimethylphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dimethylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469085 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dimethylphenyl)prop-2-enyl]carbamate |
| SMILES | Cc1ccc(C)c(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C26H25NO2/c1-18-13-14-19(2)20(16-18)8-7-15-27-26(28)29-17-25-23-11-5-3-9-21(23)22-10-4-6-12-24(22)25/h3-14,16,25H,15,17H2,1-2H3,(H,27,28) |
| InChIKey | HGXAMUUHTQBWBA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |