C25H23NO3 — CID 169469151
9H-fluoren-9-ylmethyl N-[3-(4-hydroxy-2-methylphenyl)prop-2-enyl]carbamate (PubChem CID 169469151) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-hydroxy-2-methylphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-hydroxy-2-methylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469151 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-hydroxy-2-methylphenyl)prop-2-enyl]carbamate |
| SMILES | Cc1cc(O)ccc1C=CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H23NO3/c1-17-15-19(27)13-12-18(17)7-6-14-26-25(28)29-16-24-22-10-4-2-8-20(22)21-9-3-5-11-23(21)24/h2-13,15,24,27H,14,16H2,1H3,(H,26,28) |
| InChIKey | YCFLZNMPSDMQOX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |