C25H21NO4 — CID 169469390
9H-fluoren-9-ylmethyl N-[3-(2-formyl-4-hydroxyphenyl)prop-2-enyl]carbamate (PubChem CID 169469390) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-formyl-4-hydroxyphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-formyl-4-hydroxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469390 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-formyl-4-hydroxyphenyl)prop-2-enyl]carbamate |
| SMILES | O=Cc1cc(O)ccc1C=CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H21NO4/c27-15-18-14-19(28)12-11-17(18)6-5-13-26-25(29)30-16-24-22-9-3-1-7-20(22)21-8-2-4-10-23(21)24/h1-12,14-15,24,28H,13,16H2,(H,26,29) |
| InChIKey | RBQKGGMVDMCQPV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|