C25H21NO5 — CID 169469890
4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-3-hydroxybenzoic acid (PubChem CID 169469890) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-3-hydroxybenzoic acid.
| Compound Name | 4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 169469890 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-3-hydroxybenzoic acid |
| SMILES | O=C(NCC=Cc1ccc(C(=O)O)cc1O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H21NO5/c27-23-14-17(24(28)29)12-11-16(23)6-5-13-26-25(30)31-15-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-12,14,22,27H,13,15H2,(H,26,30)(H,28,29) |
| InChIKey | ZMKZFAQPJIPATH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |