C24H21NO4 — CID 169469119
9H-fluoren-9-ylmethyl N-[3-(2,6-dihydroxyphenyl)prop-2-enyl]carbamate (PubChem CID 169469119) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,6-dihydroxyphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,6-dihydroxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469119 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,6-dihydroxyphenyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1c(O)cccc1O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21NO4/c26-22-12-5-13-23(27)20(22)11-6-14-25-24(28)29-15-21-18-9-3-1-7-16(18)17-8-2-4-10-19(17)21/h1-13,21,26-27H,14-15H2,(H,25,28) |
| InChIKey | DJSCJISPWRPWPB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |