C25H22N2O6S — CID 169470486
9H-fluoren-9-ylmethyl N-[3-(4-methylsulfonyl-2-nitrophenyl)prop-2-enyl]carbamate (PubChem CID 169470486) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-methylsulfonyl-2-nitrophenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-methylsulfonyl-2-nitrophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470486 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-methylsulfonyl-2-nitrophenyl)prop-2-enyl]carbamate |
| SMILES | CS(=O)(=O)c1ccc(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N2O6S/c1-34(31,32)18-13-12-17(24(15-18)27(29)30)7-6-14-26-25(28)33-16-23-21-10-4-2-8-19(21)20-9-3-5-11-22(20)23/h2-13,15,23H,14,16H2,1H3,(H,26,28) |
| InChIKey | CIXQBJLSLVZUNQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|