C24H19FN2O5 — CID 169470233
9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-hydroxy-5-nitrophenyl)prop-2-enyl]carbamate (PubChem CID 169470233) has the molecular formula C24H19FN2O5 and a molecular weight of 434.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-hydroxy-5-nitrophenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-hydroxy-5-nitrophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470233 |
| Molecular Formula | C24H19FN2O5 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2-fluoro-4-hydroxy-5-nitrophenyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cc([N+](=O)[O-])c(O)cc1F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19FN2O5/c25-21-13-23(28)22(27(30)31)12-15(21)6-5-11-26-24(29)32-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-10,12-13,20,28H,11,14H2,(H,26,29) |
| InChIKey | RJUWQCJKPFELSD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|