C26H23ClFNO2 — CID 170492072
9H-fluoren-9-ylmethyl N-[4-(5-chloro-2-fluoro-4-methylphenyl)but-3-enyl]carbamate (PubChem CID 170492072) has the molecular formula C26H23ClFNO2 and a molecular weight of 435.93 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(5-chloro-2-fluoro-4-methylphenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(5-chloro-2-fluoro-4-methylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492072 |
| Molecular Formula | C26H23ClFNO2 |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(5-chloro-2-fluoro-4-methylphenyl)but-3-enyl]carbamate |
| SMILES | Cc1cc(F)c(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1Cl |
| InChI | InChI=1S/C26H23ClFNO2/c1-17-14-25(28)18(15-24(17)27)8-6-7-13-29-26(30)31-16-23-21-11-4-2-9-19(21)20-10-3-5-12-22(20)23/h2-6,8-12,14-15,23H,7,13,16H2,1H3,(H,29,30) |
| InChIKey | KZHFAQGUNKSXPP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|