C27H24FNO4 — CID 170492767
2-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-fluorophenyl]acetic acid (PubChem CID 170492767) has the molecular formula C27H24FNO4 and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-fluorophenyl]acetic acid.
| Compound Name | 2-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 170492767 |
| Molecular Formula | C27H24FNO4 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-2-fluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1F |
| InChI | InChI=1S/C27H24FNO4/c28-25-15-18(12-13-19(25)16-26(30)31)7-5-6-14-29-27(32)33-17-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-5,7-13,15,24H,6,14,16-17H2,(H,29,32)(H,30,31) |
| InChIKey | IDGRBQBRNCMXID-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|