C25H21ClFNO2 — CID 169469379
9H-fluoren-9-ylmethyl N-[3-[4-(chloromethyl)-3-fluorophenyl]prop-2-enyl]carbamate (PubChem CID 169469379) has the molecular formula C25H21ClFNO2 and a molecular weight of 421.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-(chloromethyl)-3-fluorophenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-(chloromethyl)-3-fluorophenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469379 |
| Molecular Formula | C25H21ClFNO2 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-(chloromethyl)-3-fluorophenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(CCl)c(F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H21ClFNO2/c26-15-18-12-11-17(14-24(18)27)6-5-13-28-25(29)30-16-23-21-9-3-1-7-19(21)20-8-2-4-10-22(20)23/h1-12,14,23H,13,15-16H2,(H,28,29) |
| InChIKey | ZXNZRYLNASZSJX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|