C25H21F3N2O3 — CID 169470459
9H-fluoren-9-ylmethyl N-[3-[4-amino-3-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate (PubChem CID 169470459) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-amino-3-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-amino-3-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470459 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-amino-3-(trifluoromethoxy)phenyl]prop-2-enyl]carbamate |
| SMILES | Nc1ccc(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1OC(F)(F)F |
| InChI | InChI=1S/C25H21F3N2O3/c26-25(27,28)33-23-14-16(11-12-22(23)29)6-5-13-30-24(31)32-15-21-19-9-3-1-7-17(19)18-8-2-4-10-20(18)21/h1-12,14,21H,13,15,29H2,(H,30,31) |
| InChIKey | FPZMARQZFBLGPM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|