C26H22F3NO3 — CID 169470404
9H-fluoren-9-ylmethyl N-[3-[3-methoxy-4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 169470404) has the molecular formula C26H22F3NO3 and a molecular weight of 453.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[3-methoxy-4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[3-methoxy-4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470404 |
| Molecular Formula | C26H22F3NO3 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[3-methoxy-4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | COc1cc(C=CCNC(=O)OCC2c3ccccc3-c3ccccc32)ccc1C(F)(F)F |
| InChI | InChI=1S/C26H22F3NO3/c1-32-24-15-17(12-13-23(24)26(27,28)29)7-6-14-30-25(31)33-16-22-20-10-4-2-8-18(20)19-9-3-5-11-21(19)22/h2-13,15,22H,14,16H2,1H3,(H,30,31) |
| InChIKey | JGDHHIUAVSQAJH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |